110-18-9

Name:
N,N,N',N'-tetramethylethane-1,2-diamine
Cas No.:
110-18-9 
Formula:
C6H16N2  
Synonyms:

TMEDA; N,N,N',N'-Tetramethylethylenediamine;N,N,N',N'-tetramethylethane-1,2-diamine; 110-18-9;Temed; 1,2-Bis(dimethylamino)ethane; N,N,N',N'-tetramethylethane-1,2-diamine; 

110-19-0

Name:
2-methylpropyl acetate
Cas No.:
110-19-0 
Formula:
C6H12O2  
Synonyms:

isobutyl ester; Isobutyl ethanoate;2-Methylpropyl acetate; Acetic acid; 110-19-0; 2-methylpropyl ester;2-methylpropyl acetate; 

7677-21-6

Name:
N,N,N,N-tetramethylethane-1,2-diamine
Cas No.:
7677-21-6 
Formula:
C6H16N2  
Synonyms:

Temed;TMEDA;N,N,N',N'-Tetramethylethylenediamine;N,N,N',N'-tetramethylethane-1,2-diamine;Tetramethyldiaminoethane;Tetrameen;1,2-Ethanediamine, N,N,N',N'-tetramethyl-;Propamine D;1,2-Bis(dimethylamino)ethane;Ethylenediamine, N,N,N',N'-tetramethyl-;Tetramethylethylenediamine;110-18-9;Tetramethyl ethylene diamine;CCRIS 4870;1,2-Bis-(dimethylamino)ethane;HSDB 5396;N,N,N',N'-TETRAMETHYL-1,2-ETHANEDIAMINE;EINECS 203-744-6;N,N,N',N'-Tetramethylethanediamine;UN2372;Dimethyl(2-(dimethylamino)ethyl)amine;AI3-26631;N,N,N',N'-Tetramethyl-1,2-diaminoethane;N,N,N',N'-TETRAMETHYL-ETHYLENEDIAMINE;tmen;AC1Q3WSC;AC1Q4TLD;AC1L1Q4C;T7024_SIGMA;T9281_SIGMA;1,2-Di-(dimethylamino)ethane;411019_ALDRICH;Jsp000789;CHEBI:32850;T22500_SIAL;MolPort-001-770-061;BB_SC-9406;HMS1787N22;AR-1K0757;BBL011565;LS-501;STL146736;[2-(dimethylamino)ethyl]dimethylamine;AKOS000119849;AG-D-27455;NCGC00248573-01;T0147;T2515;1,2-Ethanediamine, N1,N1,N2,N2-tetramethyl-;27671-EP2270014A1;27671-EP2277878A1;27671-EP2289965A1;27671-EP2295438A1;27671-EP2298767A1;27671-EP2308857A1;27671-EP2314587A1;59079-EP2270011A1;59079-EP2277878A1;59079-EP2286915A2;59079-EP2287153A1;59079-EP2289894A2;59079-EP2305695A2;59079-EP2305696A2;59079-EP2305697A2;59079-EP2305698A2;59079-EP2308861A1;59079-EP2308882A1;59079-EP2374454A1;74324-EP2270011A1;74324-EP2286915A2;74324-EP2292597A1;74324-EP2308857A1;74324-EP2371831A1;74324-EP2374454A1;A802159;I05-0175;T0400-1565;1,2-Di-(dimethylamino)ethane [UN2372] [Flammable liquid];1,2-Di-(dimethylamino)ethane [UN2372] [Flammable liquid];InChI=1/C6H16N2/c1-7(2)5-6-8(3)4/h5-6H2,1-4H 

76774-50-0

Name:
Benzacenaphthylene
Cas No.:
76774-50-0 
Formula:
C16H10  
Synonyms:

FLUORANTHENE;Idryl;206-44-0;Benzo(jk)fluorene;Benzo[jk]fluorene;Benzo[j,k]fluorene;Benzene, 1,2-(1,8-naphthalenediyl)-;1,2-Benzacenaphthene;RCRA waste no. U120;RCRA waste number U120;CCRIS 1034;CHEBI:33083;HSDB 5486;1,2-(1,8-Naphthylene)benzene;NSC 6803;1,2-(1,8-Naphthalenediyl)benzene;EINECS 205-912-4;Fluoranthene solution;Benzene, 1,2-(1,8-naphthylene)-;Fluroanthene;Benzacenaphthylene;AC1L1SFV;1,8-Naphthylene)benzene;BCR160R_FLUKA;F807_ALDRICH;MLS002177805;40037_SUPELCO;48535_SUPELCO;48662_SUPELCO;423947_ALDRICH;45504_RIEDEL;CHEMBL355014;Jsp004228;45504_FLUKA;Benzene,2-(1,8-naphthylene)-;NSC6803;MolPort-001-787-035;HMS2268M14;NSC-6803;WLN: L C6566 1A PJ;Benzene,2-(1,8-naphthalenediyl)-;C16H10;CCG-50891;ZINC08585874;AKOS003617663;AG-E-51452;NCGC00090998-01;NCGC00090998-02;NCGC00090998-03;NCGC00090998-04;LS-69112;SMR000112026;F0016;C19425;A814763;I14-4660;SR-01000640231-1;F0074-0087;1D41162B-880B-494F-9960-6EEAC8E4EEE3;76774-50-0;InChI=1/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10